About 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one
7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 66859400) has the molecular formula C14H15FO3
and a molecular weight of 250.27 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one.
Molecular Properties
| Compound Name | 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one |
| PubChem CID | 66859400 |
| Molecular Formula | C14H15FO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | O=C1CCC2(CC1c1ccc(F)cc1)OCCO2 |
| InChI | InChI=1S/C14H15FO3/c15-11-3-1-10(2-4-11)12-9-14(6-5-13(12)16)17-7-8-18-14/h1-4,12H,5-9H2 |
| InChIKey | DENZZUHKZJZSQI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one?
The IUPAC name of 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one (CID 66859400) is 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one.
What is the SMILES notation for 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one?
The canonical SMILES for 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one is O=C1CCC2(CC1c1ccc(F)cc1)OCCO2.
What is the InChIKey of 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one?
The InChIKey is DENZZUHKZJZSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FO3/c15-11-3-1-10(2-4-11)12-9-14(6-5-13(12)16)17-7-8-18-14/h1-4,12H,5-9H2.
What are the key properties of 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one?
7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one has a molecular weight of 250.27 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-one is sourced from PubChem (CID 66859400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).