C24H26ClFN6O — CID 66859415
5-[5-chloro-1-(4-fluorophenyl)pentyl]-N-[3-methoxy-4-(1-methylpyrazol-4-yl)phenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 66859415) has the molecular formula C24H26ClFN6O and a molecular weight of 468.96 g/mol. Its IUPAC name is 5-[5-chloro-1-(4-fluorophenyl)pentyl]-N-[3-methoxy-4-(1-methylpyrazol-4-yl)phenyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[5-chloro-1-(4-fluorophenyl)pentyl]-N-[3-methoxy-4-(1-methylpyrazol-4-yl)phenyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 66859415 |
| Molecular Formula | C24H26ClFN6O |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 5-[5-chloro-1-(4-fluorophenyl)pentyl]-N-[3-methoxy-4-(1-methylpyrazol-4-yl)phenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | COc1cc(Nc2n[nH]c(C(CCCCCl)c3ccc(F)cc3)n2)ccc1-c1cnn(C)c1 |
| InChI | InChI=1S/C24H26ClFN6O/c1-32-15-17(14-27-32)20-11-10-19(13-22(20)33-2)28-24-29-23(30-31-24)21(5-3-4-12-25)16-6-8-18(26)9-7-16/h6-11,13-15,21H,3-5,12H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | KXHHIFSTOGEBCZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|