C14H27NO4 — CID 66859524
tert-butyl (3S)-3-[(1R)-1-hydroxy-2-propan-2-yloxyethyl]pyrrolidine-1-carboxylate (PubChem CID 66859524) has the molecular formula C14H27NO4 and a molecular weight of 273.37 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(1R)-1-hydroxy-2-propan-2-yloxyethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(1R)-1-hydroxy-2-propan-2-yloxyethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66859524 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | tert-butyl (3S)-3-[(1R)-1-hydroxy-2-propan-2-yloxyethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)OC[C@H](O)[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H27NO4/c1-10(2)18-9-12(16)11-6-7-15(8-11)13(17)19-14(3,4)5/h10-12,16H,6-9H2,1-5H3/t11-,12-/m0/s1 |
| InChIKey | QLFAQMZGMLSONE-RYUDHWBXSA-N |
| XLogP | 2.03 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |