C20H26ClN5O3S — CID 66859585
N-[2-[5-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-1,3-dimethylpyrazol-4-yl]ethylsulfonyl]hexanamide (PubChem CID 66859585) has the molecular formula C20H26ClN5O3S and a molecular weight of 451.98 g/mol. Its IUPAC name is N-[2-[5-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-1,3-dimethylpyrazol-4-yl]ethylsulfonyl]hexanamide.
| Compound Name | N-[2-[5-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-1,3-dimethylpyrazol-4-yl]ethylsulfonyl]hexanamide |
|---|---|
| PubChem CID | 66859585 |
| Molecular Formula | C20H26ClN5O3S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[2-[5-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-1,3-dimethylpyrazol-4-yl]ethylsulfonyl]hexanamide |
| SMILES | CCCCCC(=O)NS(=O)(=O)CCc1c(C)nn(C)c1-n1ccc2cc(Cl)cnc21 |
| InChI | InChI=1S/C20H26ClN5O3S/c1-4-5-6-7-18(27)24-30(28,29)11-9-17-14(2)23-25(3)20(17)26-10-8-15-12-16(21)13-22-19(15)26/h8,10,12-13H,4-7,9,11H2,1-3H3,(H,24,27) |
| InChIKey | OHZJFDHHKLRMJX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|