C21H20FN3O3S — CID 66859734
3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-(methylsulfonylmethyl)phenyl]prop-2-enamide (PubChem CID 66859734) has the molecular formula C21H20FN3O3S and a molecular weight of 413.47 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-(methylsulfonylmethyl)phenyl]prop-2-enamide.
| Compound Name | 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-(methylsulfonylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 66859734 |
| Molecular Formula | C21H20FN3O3S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]-N-[4-(methylsulfonylmethyl)phenyl]prop-2-enamide |
| SMILES | Cn1ncc(C=CC(=O)Nc2ccc(CS(C)(=O)=O)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN3O3S/c1-25-21(16-5-8-18(22)9-6-16)17(13-23-25)7-12-20(26)24-19-10-3-15(4-11-19)14-29(2,27)28/h3-13H,14H2,1-2H3,(H,24,26) |
| InChIKey | WQJINTAIUGLFSX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|