C19H23N3O3 — CID 66859739
(2E)-2-[[5-(6-methoxy-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazol-4-yl]methylidene]butanoic acid (PubChem CID 66859739) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2E)-2-[[5-(6-methoxy-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazol-4-yl]methylidene]butanoic acid.
| Compound Name | (2E)-2-[[5-(6-methoxy-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazol-4-yl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 66859739 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (2E)-2-[[5-(6-methoxy-2,3-dihydroindol-1-yl)-1,3-dimethylpyrazol-4-yl]methylidene]butanoic acid |
| SMILES | CC/C(=C\c1c(C)nn(C)c1N1CCc2ccc(OC)cc21)C(=O)O |
| InChI | InChI=1S/C19H23N3O3/c1-5-13(19(23)24)10-16-12(2)20-21(3)18(16)22-9-8-14-6-7-15(25-4)11-17(14)22/h6-7,10-11H,5,8-9H2,1-4H3,(H,23,24)/b13-10+ |
| InChIKey | AWGMDFJCRCTUPB-JLHYYAGUSA-N |
| XLogP | 3.31 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|