About CID 66859796
CID 66859796 (PubChem CID 66859796) has the molecular formula C19H33N2OSn
and a molecular weight of 424.20 g/mol.
Molecular Properties
| Compound Name | CID 66859796 |
| PubChem CID | 66859796 |
| Molecular Formula | C19H33N2OSn |
| Molecular Weight | 424.20 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | — |
| SMILES | CCCC[Sn](CCCC)CC(CC)c1ccccc1C(=O)NN |
| InChI | InChI=1S/C11H15N2O.2C4H9.Sn/c1-3-8(2)9-6-4-5-7-10(9)11(14)13-12;2*1-3-4-2;/h4-8H,2-3,12H2,1H3,(H,13,14);2*1,3-4H2,2H3; |
| InChIKey | NNFOOAZQGIJQME-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.20 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 66859796 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66859796?
The IUPAC name of CID 66859796 (CID 66859796) is not available.
What is the SMILES notation for CID 66859796?
The canonical SMILES for CID 66859796 is CCCC[Sn](CCCC)CC(CC)c1ccccc1C(=O)NN.
What is the InChIKey of CID 66859796?
The InChIKey is NNFOOAZQGIJQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N2O.2C4H9.Sn/c1-3-8(2)9-6-4-5-7-10(9)11(14)13-12;2*1-3-4-2;/h4-8H,2-3,12H2,1H3,(H,13,14);2*1,3-4H2,2H3;.
What are the key properties of CID 66859796?
CID 66859796 has a molecular weight of 424.20 g/mol, XLogP of 4.88, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66859796 is sourced from PubChem (CID 66859796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).