About 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine
5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine (PubChem CID 66859970) has the molecular formula C6H9BrN2OS
and a molecular weight of 237.12 g/mol. Its IUPAC name is 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine |
| PubChem CID | 66859970 |
| Molecular Formula | C6H9BrN2OS |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine |
| SMILES | [H]/N=c1\sc(Br)cn1CCOC |
| InChI | InChI=1S/C6H9BrN2OS/c1-10-3-2-9-4-5(7)11-6(9)8/h4,8H,2-3H2,1H3/b8-6- |
| InChIKey | NKXMONRWNKLQMH-VURMDHGXSA-N |
| XLogP | 1.44 |
| TPSA | 38.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine?
The IUPAC name of 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine (CID 66859970) is 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine.
What is the SMILES notation for 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine?
The canonical SMILES for 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine is [H]/N=c1\sc(Br)cn1CCOC.
What is the InChIKey of 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine?
The InChIKey is NKXMONRWNKLQMH-VURMDHGXSA-N. The full InChI is InChI=1S/C6H9BrN2OS/c1-10-3-2-9-4-5(7)11-6(9)8/h4,8H,2-3H2,1H3/b8-6-.
What are the key properties of 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine?
5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine has a molecular weight of 237.12 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(2-methoxyethyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 66859970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).