About N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide
N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide (PubChem CID 66860052) has the molecular formula C4H6N2O5S
and a molecular weight of 194.17 g/mol. Its IUPAC name is N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide |
| PubChem CID | 66860052 |
| Molecular Formula | C4H6N2O5S |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide |
| SMILES | CNS(=O)(=O)N1C(=O)COC1=O |
| InChI | InChI=1S/C4H6N2O5S/c1-5-12(9,10)6-3(7)2-11-4(6)8/h5H,2H2,1H3 |
| InChIKey | XTLXOJSYIMAPBY-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide?
The IUPAC name of N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide (CID 66860052) is N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide.
What is the SMILES notation for N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide?
The canonical SMILES for N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide is CNS(=O)(=O)N1C(=O)COC1=O.
What is the InChIKey of N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide?
The InChIKey is XTLXOJSYIMAPBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O5S/c1-5-12(9,10)6-3(7)2-11-4(6)8/h5H,2H2,1H3.
What are the key properties of N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide?
N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide has a molecular weight of 194.17 g/mol, XLogP of -1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2,4-dioxo-1,3-oxazolidine-3-sulfonamide is sourced from PubChem (CID 66860052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).