C30H37F3O3 — CID 66860433
(8R,9S,13S,14S)-15-(4-hydroxybutyl)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol (PubChem CID 66860433) has the molecular formula C30H37F3O3 and a molecular weight of 502.62 g/mol. Its IUPAC name is (8R,9S,13S,14S)-15-(4-hydroxybutyl)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9S,13S,14S)-15-(4-hydroxybutyl)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 66860433 |
| Molecular Formula | C30H37F3O3 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | (8R,9S,13S,14S)-15-(4-hydroxybutyl)-13-methyl-3-phenylmethoxy-17-(trifluoromethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1C(CCCCO)CC2(O)C(F)(F)F |
| InChI | InChI=1S/C30H37F3O3/c1-28-15-14-25-24-13-11-23(36-19-20-7-3-2-4-8-20)17-21(24)10-12-26(25)27(28)22(9-5-6-16-34)18-29(28,35)30(31,32)33/h2-4,7-8,11,13,17,22,25-27,34-35H,5-6,9-10,12,14-16,18-19H2,1H3/t22?,25-,26-,27+,28+,29?/m1/s1 |
| InChIKey | GKMLLBGSODSSIU-OIKCBMDCSA-N |
| XLogP | 6.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|