C17H12F3N3O2 — CID 66860525
1-phenyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-1-(trifluoromethoxy)but-3-yn-2-ol (PubChem CID 66860525) has the molecular formula C17H12F3N3O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 1-phenyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-1-(trifluoromethoxy)but-3-yn-2-ol.
| Compound Name | 1-phenyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-1-(trifluoromethoxy)but-3-yn-2-ol |
|---|---|
| PubChem CID | 66860525 |
| Molecular Formula | C17H12F3N3O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-phenyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-yl)-1-(trifluoromethoxy)but-3-yn-2-ol |
| SMILES | OC(C#Cc1nnc2ccccn12)C(OC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H12F3N3O2/c18-17(19,20)25-16(12-6-2-1-3-7-12)13(24)9-10-15-22-21-14-8-4-5-11-23(14)15/h1-8,11,13,16,24H |
| InChIKey | WCXQUFCPZMNICF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|