About 1-cyclopentyl-1,3-diethylurea
1-cyclopentyl-1,3-diethylurea (PubChem CID 66860832) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-cyclopentyl-1,3-diethylurea.
Molecular Properties
| Compound Name | 1-cyclopentyl-1,3-diethylurea |
| PubChem CID | 66860832 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 1-cyclopentyl-1,3-diethylurea |
| SMILES | CCNC(=O)N(CC)C1CCCC1 |
| InChI | InChI=1S/C10H20N2O/c1-3-11-10(13)12(4-2)9-7-5-6-8-9/h9H,3-8H2,1-2H3,(H,11,13) |
| InChIKey | DSGIEKWBDOSACI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopentyl-1,3-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-1,3-diethylurea?
The IUPAC name of 1-cyclopentyl-1,3-diethylurea (CID 66860832) is 1-cyclopentyl-1,3-diethylurea.
What is the SMILES notation for 1-cyclopentyl-1,3-diethylurea?
The canonical SMILES for 1-cyclopentyl-1,3-diethylurea is CCNC(=O)N(CC)C1CCCC1.
What is the InChIKey of 1-cyclopentyl-1,3-diethylurea?
The InChIKey is DSGIEKWBDOSACI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-3-11-10(13)12(4-2)9-7-5-6-8-9/h9H,3-8H2,1-2H3,(H,11,13).
What are the key properties of 1-cyclopentyl-1,3-diethylurea?
1-cyclopentyl-1,3-diethylurea has a molecular weight of 184.28 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-1,3-diethylurea is sourced from PubChem (CID 66860832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).