C21H27N3O2S — CID 66860959
1-(2-adamantyl)-3-[3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]urea (PubChem CID 66860959) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-(2-adamantyl)-3-[3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]urea.
| Compound Name | 1-(2-adamantyl)-3-[3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]urea |
|---|---|
| PubChem CID | 66860959 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-(2-adamantyl)-3-[3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]urea |
| SMILES | COCCn1c(=NC(=O)NC2C3CC4CC(C3)CC2C4)sc2ccccc21 |
| InChI | InChI=1S/C21H27N3O2S/c1-26-7-6-24-17-4-2-3-5-18(17)27-21(24)23-20(25)22-19-15-9-13-8-14(11-15)12-16(19)10-13/h2-5,13-16,19H,6-12H2,1H3,(H,22,25) |
| InChIKey | RODHORYZKBEDSX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |