C24H30O5S3 — CID 66861042
2-[3-[(1R,2S,3R)-2-[(E,3S)-5-(1-benzothiophen-2-yl)-3-hydroxy-3-methylpent-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid (PubChem CID 66861042) has the molecular formula C24H30O5S3 and a molecular weight of 494.70 g/mol. Its IUPAC name is 2-[3-[(1R,2S,3R)-2-[(E,3S)-5-(1-benzothiophen-2-yl)-3-hydroxy-3-methylpent-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid.
| Compound Name | 2-[3-[(1R,2S,3R)-2-[(E,3S)-5-(1-benzothiophen-2-yl)-3-hydroxy-3-methylpent-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 66861042 |
| Molecular Formula | C24H30O5S3 |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 2-[3-[(1R,2S,3R)-2-[(E,3S)-5-(1-benzothiophen-2-yl)-3-hydroxy-3-methylpent-1-enyl]-3-hydroxy-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetic acid |
| SMILES | C[C@@](O)(/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1SCCCSCC(=O)O)CCc1cc2ccccc2s1 |
| InChI | InChI=1S/C24H30O5S3/c1-24(29,9-7-17-13-16-5-2-3-6-21(16)32-17)10-8-18-19(25)14-20(26)23(18)31-12-4-11-30-15-22(27)28/h2-3,5-6,8,10,13,18-19,23,25,29H,4,7,9,11-12,14-15H2,1H3,(H,27,28)/b10-8+/t18-,19+,23+,24-/m0/s1 |
| InChIKey | TZVABWGPMSZSAI-IKMZAFFISA-N |
| XLogP | 4.40 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|