C8H14N2S — CID 66861287
2,4,4a,5,6,7-hexahydro-1H-3,1-benzothiazin-2-amine (PubChem CID 66861287) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 2,4,4a,5,6,7-hexahydro-1H-3,1-benzothiazin-2-amine.
| Compound Name | 2,4,4a,5,6,7-hexahydro-1H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 66861287 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2,4,4a,5,6,7-hexahydro-1H-3,1-benzothiazin-2-amine |
| SMILES | NC1NC2=CCCCC2CS1 |
| InChI | InChI=1S/C8H14N2S/c9-8-10-7-4-2-1-3-6(7)5-11-8/h4,6,8,10H,1-3,5,9H2 |
| InChIKey | BSDDFMOFAHQMED-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |