C30H33O5P — CID 66861896
(5,5-dimethyl-4-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-2,8,10-trien-10-yl) 1,2-diphenylethyl hydrogen phosphate (PubChem CID 66861896) has the molecular formula C30H33O5P and a molecular weight of 504.56 g/mol. Its IUPAC name is (5,5-dimethyl-4-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-2,8,10-trien-10-yl) 1,2-diphenylethyl hydrogen phosphate.
| Compound Name | (5,5-dimethyl-4-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-2,8,10-trien-10-yl) 1,2-diphenylethyl hydrogen phosphate |
|---|---|
| PubChem CID | 66861896 |
| Molecular Formula | C30H33O5P |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (5,5-dimethyl-4-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-2,8,10-trien-10-yl) 1,2-diphenylethyl hydrogen phosphate |
| SMILES | CC1(C)CCc2cc(OP(=O)(O)OC(Cc3ccccc3)c3ccccc3)c3c(c2O1)C1CCC3C1 |
| InChI | InChI=1S/C30H33O5P/c1-30(2)16-15-24-19-26(27-22-13-14-23(18-22)28(27)29(24)33-30)35-36(31,32)34-25(21-11-7-4-8-12-21)17-20-9-5-3-6-10-20/h3-12,19,22-23,25H,13-18H2,1-2H3,(H,31,32) |
| InChIKey | ZVMAFXPYWFEQAW-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|