C16H18O2 — CID 66862030
5,5-dimethyl-4-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-2,8,10,13-tetraen-10-ol (PubChem CID 66862030) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 5,5-dimethyl-4-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-2,8,10,13-tetraen-10-ol.
| Compound Name | 5,5-dimethyl-4-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-2,8,10,13-tetraen-10-ol |
|---|---|
| PubChem CID | 66862030 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5,5-dimethyl-4-oxatetracyclo[10.2.1.02,11.03,8]pentadeca-2,8,10,13-tetraen-10-ol |
| SMILES | CC1(C)CCc2cc(O)c3c(c2O1)C1C=CC3C1 |
| InChI | InChI=1S/C16H18O2/c1-16(2)6-5-11-8-12(17)13-9-3-4-10(7-9)14(13)15(11)18-16/h3-4,8-10,17H,5-7H2,1-2H3 |
| InChIKey | HSCXKCGXUWTTKF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|