About 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline
1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline (PubChem CID 66862046) has the molecular formula C20H15ClF3N3O
and a molecular weight of 405.81 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline.
Molecular Properties
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline |
| PubChem CID | 66862046 |
| Molecular Formula | C20H15ClF3N3O |
| Molecular Weight | 405.81 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline |
| SMILES | COc1ccc2nc(C)c3c(C)nc(-c4ccc(Cl)cc4C(F)(F)F)n3c2c1 |
| InChI | InChI=1S/C20H15ClF3N3O/c1-10-18-11(2)26-19(14-6-4-12(21)8-15(14)20(22,23)24)27(18)17-9-13(28-3)5-7-16(17)25-10/h4-9H,1-3H3 |
| InChIKey | ZMGIWHGMLASEKN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.81 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline?
The IUPAC name of 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline (CID 66862046) is 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline.
What is the SMILES notation for 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline?
The canonical SMILES for 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline is COc1ccc2nc(C)c3c(C)nc(-c4ccc(Cl)cc4C(F)(F)F)n3c2c1.
What is the InChIKey of 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline?
The InChIKey is ZMGIWHGMLASEKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15ClF3N3O/c1-10-18-11(2)26-19(14-6-4-12(21)8-15(14)20(22,23)24)27(18)17-9-13(28-3)5-7-16(17)25-10/h4-9H,1-3H3.
What are the key properties of 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline?
1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline has a molecular weight of 405.81 g/mol, XLogP of 5.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-chloro-2-(trifluoromethyl)phenyl]-8-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline is sourced from PubChem (CID 66862046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).