About [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid
[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid (PubChem CID 66862092) has the molecular formula C16H34N2O3Si
and a molecular weight of 330.55 g/mol. Its IUPAC name is [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid.
Molecular Properties
| Compound Name | [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid |
| PubChem CID | 66862092 |
| Molecular Formula | C16H34N2O3Si |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid |
| SMILES | C[Si](C)(C)CCN(C[C@H](O)[C@@H](N)CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C16H34N2O3Si/c1-22(2,3)10-9-18(16(20)21)12-15(19)14(17)11-13-7-5-4-6-8-13/h13-15,19H,4-12,17H2,1-3H3,(H,20,21)/t14-,15-/m0/s1 |
| InChIKey | UAJSFXIJPIVBKU-GJZGRUSLSA-N |
| XLogP | 2.96 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid?
The IUPAC name of [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid (CID 66862092) is [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid.
What is the SMILES notation for [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid?
The canonical SMILES for [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid is C[Si](C)(C)CCN(C[C@H](O)[C@@H](N)CC1CCCCC1)C(=O)O.
What is the InChIKey of [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid?
The InChIKey is UAJSFXIJPIVBKU-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H34N2O3Si/c1-22(2,3)10-9-18(16(20)21)12-15(19)14(17)11-13-7-5-4-6-8-13/h13-15,19H,4-12,17H2,1-3H3,(H,20,21)/t14-,15-/m0/s1.
What are the key properties of [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid?
[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid has a molecular weight of 330.55 g/mol, XLogP of 2.96, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-(2-trimethylsilylethyl)carbamic acid is sourced from PubChem (CID 66862092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).