About N,N-diethylethanamine;oxetane
N,N-diethylethanamine;oxetane (PubChem CID 66862478) has the molecular formula C12H27NO2
and a molecular weight of 217.35 g/mol. Its IUPAC name is N,N-diethylethanamine;oxetane.
Molecular Properties
| Compound Name | N,N-diethylethanamine;oxetane |
| PubChem CID | 66862478 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | N,N-diethylethanamine;oxetane |
| SMILES | C1COC1.C1COC1.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.2C3H6O/c1-4-7(5-2)6-3;2*1-2-4-3-1/h4-6H2,1-3H3;2*1-3H2 |
| InChIKey | NQSNHHXCKUZQAI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethylethanamine;oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;oxetane?
The IUPAC name of N,N-diethylethanamine;oxetane (CID 66862478) is N,N-diethylethanamine;oxetane.
What is the SMILES notation for N,N-diethylethanamine;oxetane?
The canonical SMILES for N,N-diethylethanamine;oxetane is C1COC1.C1COC1.CCN(CC)CC.
What is the InChIKey of N,N-diethylethanamine;oxetane?
The InChIKey is NQSNHHXCKUZQAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.2C3H6O/c1-4-7(5-2)6-3;2*1-2-4-3-1/h4-6H2,1-3H3;2*1-3H2.
What are the key properties of N,N-diethylethanamine;oxetane?
N,N-diethylethanamine;oxetane has a molecular weight of 217.35 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;oxetane is sourced from PubChem (CID 66862478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).