C28H45FN4O5 — CID 66862574
methyl N-[2-[(R)-[(3R)-1-[[1-cyclohexyl-3-hydroxy-4-(methylamino)butan-2-yl]carbamoyl]piperidin-3-yl]-(3-fluorophenyl)methoxy]ethyl]carbamate (PubChem CID 66862574) has the molecular formula C28H45FN4O5 and a molecular weight of 536.69 g/mol. Its IUPAC name is methyl N-[2-[(R)-[(3R)-1-[[1-cyclohexyl-3-hydroxy-4-(methylamino)butan-2-yl]carbamoyl]piperidin-3-yl]-(3-fluorophenyl)methoxy]ethyl]carbamate.
| Compound Name | methyl N-[2-[(R)-[(3R)-1-[[1-cyclohexyl-3-hydroxy-4-(methylamino)butan-2-yl]carbamoyl]piperidin-3-yl]-(3-fluorophenyl)methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 66862574 |
| Molecular Formula | C28H45FN4O5 |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | methyl N-[2-[(R)-[(3R)-1-[[1-cyclohexyl-3-hydroxy-4-(methylamino)butan-2-yl]carbamoyl]piperidin-3-yl]-(3-fluorophenyl)methoxy]ethyl]carbamate |
| SMILES | CNCC(O)C(CC1CCCCC1)NC(=O)N1CCC[C@@H]([C@@H](OCCNC(=O)OC)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C28H45FN4O5/c1-30-18-25(34)24(16-20-8-4-3-5-9-20)32-27(35)33-14-7-11-22(19-33)26(21-10-6-12-23(29)17-21)38-15-13-31-28(36)37-2/h6,10,12,17,20,22,24-26,30,34H,3-5,7-9,11,13-16,18-19H2,1-2H3,(H,31,36)(H,32,35)/t22-,24?,25?,26+/m1/s1 |
| InChIKey | GRUVAIQINZTNSI-KBQCUQOTSA-N |
| XLogP | 3.58 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|