About tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate
tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate (PubChem CID 66862699) has the molecular formula C12H18FN3O2S
and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate |
| PubChem CID | 66862699 |
| Molecular Formula | C12H18FN3O2S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate |
| SMILES | CN(c1ncc(F)s1)C1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H18FN3O2S/c1-12(2,3)18-11(17)16-6-8(7-16)15(4)10-14-5-9(13)19-10/h5,8H,6-7H2,1-4H3 |
| InChIKey | AITZPDLSTFEQJX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate (CID 66862699) is tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate is CN(c1ncc(F)s1)C1CN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate?
The InChIKey is AITZPDLSTFEQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FN3O2S/c1-12(2,3)18-11(17)16-6-8(7-16)15(4)10-14-5-9(13)19-10/h5,8H,6-7H2,1-4H3.
What are the key properties of tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate?
tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate has a molecular weight of 287.36 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[(5-fluoro-1,3-thiazol-2-yl)-methylamino]azetidine-1-carboxylate is sourced from PubChem (CID 66862699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).