About disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate
disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate (PubChem CID 66863421) has the molecular formula C10H6Na2O8S2
and a molecular weight of 364.26 g/mol. Its IUPAC name is disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate.
Molecular Properties
| Compound Name | disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate |
| PubChem CID | 66863421 |
| Molecular Formula | C10H6Na2O8S2 |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate |
| SMILES | O=S(=O)([O-])Oc1ccc(OS(=O)(=O)[O-])c2ccccc12.[Na+].[Na+] |
| InChI | InChI=1S/C10H8O8S2.2Na/c11-19(12,13)17-9-5-6-10(18-20(14,15)16)8-4-2-1-3-7(8)9;;/h1-6H,(H,11,12,13)(H,14,15,16);;/q;2*+1/p-2 |
| InChIKey | QQHUCUXZHDMFAM-UHFFFAOYSA-L |
| XLogP | -5.47 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate?
The IUPAC name of disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate (CID 66863421) is disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate.
What is the SMILES notation for disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate?
The canonical SMILES for disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate is O=S(=O)([O-])Oc1ccc(OS(=O)(=O)[O-])c2ccccc12.[Na+].[Na+].
What is the InChIKey of disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate?
The InChIKey is QQHUCUXZHDMFAM-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8O8S2.2Na/c11-19(12,13)17-9-5-6-10(18-20(14,15)16)8-4-2-1-3-7(8)9;;/h1-6H,(H,11,12,13)(H,14,15,16);;/q;2*+1/p-2.
What are the key properties of disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate?
disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate has a molecular weight of 364.26 g/mol, XLogP of -5.47, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;(4-sulfonatooxynaphthalen-1-yl) sulfate is sourced from PubChem (CID 66863421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).