About N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine
N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine (PubChem CID 66863926) has the molecular formula C7H10FN3S
and a molecular weight of 187.24 g/mol. Its IUPAC name is N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine |
| PubChem CID | 66863926 |
| Molecular Formula | C7H10FN3S |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine |
| SMILES | CN(c1ncc(F)s1)C1CNC1 |
| InChI | InChI=1S/C7H10FN3S/c1-11(5-2-9-3-5)7-10-4-6(8)12-7/h4-5,9H,2-3H2,1H3 |
| InChIKey | FEPKPYGIMBXCGK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine?
The IUPAC name of N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine (CID 66863926) is N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine?
The canonical SMILES for N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine is CN(c1ncc(F)s1)C1CNC1.
What is the InChIKey of N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine?
The InChIKey is FEPKPYGIMBXCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10FN3S/c1-11(5-2-9-3-5)7-10-4-6(8)12-7/h4-5,9H,2-3H2,1H3.
What are the key properties of N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine?
N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine has a molecular weight of 187.24 g/mol, XLogP of 0.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(azetidin-3-yl)-5-fluoro-N-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 66863926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).