C17H20N2O — CID 668641
(2S)-4,4-diethyl-2-pyridin-3-yl-1,2-dihydro-3,1-benzoxazine (PubChem CID 668641) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (2S)-4,4-diethyl-2-pyridin-3-yl-1,2-dihydro-3,1-benzoxazine.
| Compound Name | (2S)-4,4-diethyl-2-pyridin-3-yl-1,2-dihydro-3,1-benzoxazine |
|---|---|
| PubChem CID | 668641 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (2S)-4,4-diethyl-2-pyridin-3-yl-1,2-dihydro-3,1-benzoxazine |
| SMILES | CCC1(CC)O[C@@H](c2cccnc2)Nc2ccccc21 |
| InChI | InChI=1S/C17H20N2O/c1-3-17(4-2)14-9-5-6-10-15(14)19-16(20-17)13-8-7-11-18-12-13/h5-12,16,19H,3-4H2,1-2H3/t16-/m0/s1 |
| InChIKey | JCIABXDKKQKVHT-INIZCTEOSA-N |
| XLogP | 4.24 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |