About methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate
methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate (PubChem CID 66864439) has the molecular formula C26H25F2NO3
and a molecular weight of 437.49 g/mol. Its IUPAC name is methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate |
| PubChem CID | 66864439 |
| Molecular Formula | C26H25F2NO3 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate |
| SMILES | COC(=O)c1ccc(C2(c3ccc(OCc4ccccn4)cc3)CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C26H25F2NO3/c1-31-24(30)19-5-7-20(8-6-19)25(13-15-26(27,28)16-14-25)21-9-11-23(12-10-21)32-18-22-4-2-3-17-29-22/h2-12,17H,13-16,18H2,1H3 |
| InChIKey | HLZPZILNCNNKDX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate?
The IUPAC name of methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate (CID 66864439) is methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate.
What is the SMILES notation for methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate?
The canonical SMILES for methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate is COC(=O)c1ccc(C2(c3ccc(OCc4ccccn4)cc3)CCC(F)(F)CC2)cc1.
What is the InChIKey of methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate?
The InChIKey is HLZPZILNCNNKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25F2NO3/c1-31-24(30)19-5-7-20(8-6-19)25(13-15-26(27,28)16-14-25)21-9-11-23(12-10-21)32-18-22-4-2-3-17-29-22/h2-12,17H,13-16,18H2,1H3.
What are the key properties of methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate?
methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate has a molecular weight of 437.49 g/mol, XLogP of 5.94, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4,4-difluoro-1-[4-(pyridin-2-ylmethoxy)phenyl]cyclohexyl]benzoate is sourced from PubChem (CID 66864439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).