About 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol
6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 66864542) has the molecular formula C24H42O3
and a molecular weight of 378.60 g/mol. Its IUPAC name is 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 66864542 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | CCCCCCC(C)(C)C1(O)C=CC=CC1C1CC(O)CCC1CCCO |
| InChI | InChI=1S/C24H42O3/c1-4-5-6-8-15-23(2,3)24(27)16-9-7-12-22(24)21-18-20(26)14-13-19(21)11-10-17-25/h7,9,12,16,19-22,25-27H,4-6,8,10-11,13-15,17-18H2,1-3H3 |
| InChIKey | LXRYHZRWUIXIAO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol (CID 66864542) is 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol is CCCCCCC(C)(C)C1(O)C=CC=CC1C1CC(O)CCC1CCCO.
What is the InChIKey of 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol?
The InChIKey is LXRYHZRWUIXIAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O3/c1-4-5-6-8-15-23(2,3)24(27)16-9-7-12-22(24)21-18-20(26)14-13-19(21)11-10-17-25/h7,9,12,16,19-22,25-27H,4-6,8,10-11,13-15,17-18H2,1-3H3.
What are the key properties of 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol?
6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol has a molecular weight of 378.60 g/mol, XLogP of 5.01, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-hydroxy-2-(3-hydroxypropyl)cyclohexyl]-1-(2-methyloctan-2-yl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 66864542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).