C12H13N5 — CID 66864694
6-(2-phenylprop-1-enyl)-1,2,4-triazine-3,5-diamine (PubChem CID 66864694) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 6-(2-phenylprop-1-enyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 6-(2-phenylprop-1-enyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 66864694 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 6-(2-phenylprop-1-enyl)-1,2,4-triazine-3,5-diamine |
| SMILES | CC(=Cc1nnc(N)nc1N)c1ccccc1 |
| InChI | InChI=1S/C12H13N5/c1-8(9-5-3-2-4-6-9)7-10-11(13)15-12(14)17-16-10/h2-7H,1H3,(H4,13,14,15,17) |
| InChIKey | KQMWXNXOVIALNG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |