About 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one
3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 66865237) has the molecular formula C7H4N4O
and a molecular weight of 160.14 g/mol. Its IUPAC name is 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one |
| PubChem CID | 66865237 |
| Molecular Formula | C7H4N4O |
| Molecular Weight | 160.14 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | C#Cn1c(=O)[nH]c2nccnc21 |
| InChI | InChI=1S/C7H4N4O/c1-2-11-6-5(10-7(11)12)8-3-4-9-6/h1,3-4H,(H,8,10,12) |
| InChIKey | NKGWCDXSZNYFOM-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.14 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one?
The IUPAC name of 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one (CID 66865237) is 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one?
The canonical SMILES for 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one is C#Cn1c(=O)[nH]c2nccnc21.
What is the InChIKey of 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one?
The InChIKey is NKGWCDXSZNYFOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4O/c1-2-11-6-5(10-7(11)12)8-3-4-9-6/h1,3-4H,(H,8,10,12).
What are the key properties of 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one?
3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one has a molecular weight of 160.14 g/mol, XLogP of -0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-1H-imidazo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 66865237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).