About 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone
2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone (PubChem CID 66865257) has the molecular formula C8H4F3NOS
and a molecular weight of 219.19 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone |
| PubChem CID | 66865257 |
| Molecular Formula | C8H4F3NOS |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone |
| SMILES | O=C(c1c[nH]c2sccc12)C(F)(F)F |
| InChI | InChI=1S/C8H4F3NOS/c9-8(10,11)6(13)5-3-12-7-4(5)1-2-14-7/h1-3,12H |
| InChIKey | SSSFKSZPNQQQJD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone?
The IUPAC name of 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone (CID 66865257) is 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone.
What is the SMILES notation for 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone?
The canonical SMILES for 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone is O=C(c1c[nH]c2sccc12)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone?
The InChIKey is SSSFKSZPNQQQJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3NOS/c9-8(10,11)6(13)5-3-12-7-4(5)1-2-14-7/h1-3,12H.
What are the key properties of 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone?
2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone has a molecular weight of 219.19 g/mol, XLogP of 2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-1-(6H-thieno[2,3-b]pyrrol-4-yl)ethanone is sourced from PubChem (CID 66865257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).