About 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid
2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid (PubChem CID 66865279) has the molecular formula C25H21F3O4S
and a molecular weight of 474.50 g/mol. Its IUPAC name is 2-[[3-[2-ethoxy-2-oxo-1-[4-(trifluoromethyl)phenyl]ethyl]phenyl]sulfanylmethyl]benzoic acid.
Molecular Properties
| Compound Name | 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid |
| PubChem CID | 66865279 |
| Molecular Formula | C25H21F3O4S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-[[3-[2-ethoxy-2-oxo-1-[4-(trifluoromethyl)phenyl]ethyl]phenyl]sulfanylmethyl]benzoic acid |
| SMILES | CCOC(=O)C(C1=CC=C(C=C1)C(F)(F)F)C2=CC(=CC=C2)SCC3=CC=CC=C3C(=O)O |
| InChI | InChI=1S/C25H21F3O4S/c1-2-32-24(31)22(16-10-12-19(13-11-16)25(26,27)28)17-7-5-8-20(14-17)33-15-18-6-3-4-9-21(18)23(29)30/h3-14,22H,2,15H2,1H3,(H,29,30) |
| InChIKey | AOHXAVXTJDLNDF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | 648 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid?
The IUPAC name of 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid (CID 66865279) is 2-[[3-[2-ethoxy-2-oxo-1-[4-(trifluoromethyl)phenyl]ethyl]phenyl]sulfanylmethyl]benzoic acid.
What is the SMILES notation for 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid?
The canonical SMILES for 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid is CCOC(=O)C(C1=CC=C(C=C1)C(F)(F)F)C2=CC(=CC=C2)SCC3=CC=CC=C3C(=O)O.
What is the InChIKey of 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid?
The InChIKey is AOHXAVXTJDLNDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21F3O4S/c1-2-32-24(31)22(16-10-12-19(13-11-16)25(26,27)28)17-7-5-8-20(14-17)33-15-18-6-3-4-9-21(18)23(29)30/h3-14,22H,2,15H2,1H3,(H,29,30).
What are the key properties of 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid?
2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid has a molecular weight of 474.50 g/mol, XLogP of 6.20, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-{3-[1-(4-Trifluoromethyl-phenyl)-ethoxycarbonylmethyl]phenylsulfanylmethyl}-benzoic acid is sourced from PubChem (CID 66865279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).