C26H34Cl3FO3SSi — CID 66865315
2,2,2-trichloroethyl 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-[2-(4-fluorophenyl)ethylsulfanyl]propanoate (PubChem CID 66865315) has the molecular formula C26H34Cl3FO3SSi and a molecular weight of 580.07 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-[2-(4-fluorophenyl)ethylsulfanyl]propanoate.
| Compound Name | 2,2,2-trichloroethyl 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-[2-(4-fluorophenyl)ethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 66865315 |
| Molecular Formula | C26H34Cl3FO3SSi |
| Molecular Weight | 580.07 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 2,2,2-trichloroethyl 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-2-[2-(4-fluorophenyl)ethylsulfanyl]propanoate |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(CC(SCCc2ccc(F)cc2)C(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C26H34Cl3FO3SSi/c1-25(2,3)35(4,5)33-17-21-8-6-20(7-9-21)16-23(24(31)32-18-26(27,28)29)34-15-14-19-10-12-22(30)13-11-19/h6-13,23H,14-18H2,1-5H3 |
| InChIKey | CFFWPVQJEDZGIO-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.07 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|