C23H36F2N2O2Si — CID 66865364
(3R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3,5-difluorophenyl)-3,4,6-trimethyl-1-prop-2-enylpiperazin-2-one (PubChem CID 66865364) has the molecular formula C23H36F2N2O2Si and a molecular weight of 438.64 g/mol. Its IUPAC name is (3R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3,5-difluorophenyl)-3,4,6-trimethyl-1-prop-2-enylpiperazin-2-one.
| Compound Name | (3R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3,5-difluorophenyl)-3,4,6-trimethyl-1-prop-2-enylpiperazin-2-one |
|---|---|
| PubChem CID | 66865364 |
| Molecular Formula | C23H36F2N2O2Si |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (3R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(3,5-difluorophenyl)-3,4,6-trimethyl-1-prop-2-enylpiperazin-2-one |
| SMILES | C=CCN1C(=O)[C@@](C)(CO[Si](C)(C)C(C)(C)C)N(C)C[C@@]1(C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C23H36F2N2O2Si/c1-10-11-27-20(28)23(6,16-29-30(8,9)21(2,3)4)26(7)15-22(27,5)17-12-18(24)14-19(25)13-17/h10,12-14H,1,11,15-16H2,2-9H3/t22-,23+/m0/s1 |
| InChIKey | VDLUKOKHNGZXCE-XZOQPEGZSA-N |
| XLogP | 4.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|