About piperidin-1-ium;2,2,2-trifluoroacetate
piperidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 66865399) has the molecular formula C7H12F3NO2
and a molecular weight of 199.17 g/mol. Its IUPAC name is piperidin-1-ium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | piperidin-1-ium;2,2,2-trifluoroacetate |
| PubChem CID | 66865399 |
| Molecular Formula | C7H12F3NO2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | piperidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | C1CC[NH2+]CC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C5H11N.C2HF3O2/c1-2-4-6-5-3-1;3-2(4,5)1(6)7/h6H,1-5H2;(H,6,7) |
| InChIKey | FTMVNUGLWHCBJK-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidin-1-ium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-ium;2,2,2-trifluoroacetate?
The IUPAC name of piperidin-1-ium;2,2,2-trifluoroacetate (CID 66865399) is piperidin-1-ium;2,2,2-trifluoroacetate.
What is the SMILES notation for piperidin-1-ium;2,2,2-trifluoroacetate?
The canonical SMILES for piperidin-1-ium;2,2,2-trifluoroacetate is C1CC[NH2+]CC1.O=C([O-])C(F)(F)F.
What is the InChIKey of piperidin-1-ium;2,2,2-trifluoroacetate?
The InChIKey is FTMVNUGLWHCBJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.C2HF3O2/c1-2-4-6-5-3-1;3-2(4,5)1(6)7/h6H,1-5H2;(H,6,7).
What are the key properties of piperidin-1-ium;2,2,2-trifluoroacetate?
piperidin-1-ium;2,2,2-trifluoroacetate has a molecular weight of 199.17 g/mol, XLogP of -0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-ium;2,2,2-trifluoroacetate is sourced from PubChem (CID 66865399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).