About 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one
5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one (PubChem CID 66865730) has the molecular formula C12H15IN4O2
and a molecular weight of 374.18 g/mol. Its IUPAC name is 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one |
| PubChem CID | 66865730 |
| Molecular Formula | C12H15IN4O2 |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one |
| SMILES | COCCn1ncc(-n2c(C)nc(I)c2C)cc1=O |
| InChI | InChI=1S/C12H15IN4O2/c1-8-12(13)15-9(2)17(8)10-6-11(18)16(14-7-10)4-5-19-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | KMTSLZFWZQILOG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one?
The IUPAC name of 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one (CID 66865730) is 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one.
What is the SMILES notation for 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one?
The canonical SMILES for 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one is COCCn1ncc(-n2c(C)nc(I)c2C)cc1=O.
What is the InChIKey of 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one?
The InChIKey is KMTSLZFWZQILOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15IN4O2/c1-8-12(13)15-9(2)17(8)10-6-11(18)16(14-7-10)4-5-19-3/h6-7H,4-5H2,1-3H3.
What are the key properties of 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one?
5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one has a molecular weight of 374.18 g/mol, XLogP of 1.30, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-iodo-2,5-dimethylimidazol-1-yl)-2-(2-methoxyethyl)pyridazin-3-one is sourced from PubChem (CID 66865730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).