About (2-pentylphenyl) hydrogen carbonate
(2-pentylphenyl) hydrogen carbonate (PubChem CID 66866102) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is (2-pentylphenyl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2-pentylphenyl) hydrogen carbonate |
| PubChem CID | 66866102 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2-pentylphenyl) hydrogen carbonate |
| SMILES | CCCCCc1ccccc1OC(=O)O |
| InChI | InChI=1S/C12H16O3/c1-2-3-4-7-10-8-5-6-9-11(10)15-12(13)14/h5-6,8-9H,2-4,7H2,1H3,(H,13,14) |
| InChIKey | HQFBEVVLMDXKAC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (2-pentylphenyl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pentylphenyl) hydrogen carbonate?
The IUPAC name of (2-pentylphenyl) hydrogen carbonate (CID 66866102) is (2-pentylphenyl) hydrogen carbonate.
What is the SMILES notation for (2-pentylphenyl) hydrogen carbonate?
The canonical SMILES for (2-pentylphenyl) hydrogen carbonate is CCCCCc1ccccc1OC(=O)O.
What is the InChIKey of (2-pentylphenyl) hydrogen carbonate?
The InChIKey is HQFBEVVLMDXKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-2-3-4-7-10-8-5-6-9-11(10)15-12(13)14/h5-6,8-9H,2-4,7H2,1H3,(H,13,14).
What are the key properties of (2-pentylphenyl) hydrogen carbonate?
(2-pentylphenyl) hydrogen carbonate has a molecular weight of 208.26 g/mol, XLogP of 3.48, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pentylphenyl) hydrogen carbonate is sourced from PubChem (CID 66866102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).