C21H20Cl3FO6S — CID 66866218
2-[4-[2-[2-(4-fluorophenyl)ethylsulfonyl]-3-oxo-3-(2,2,2-trichloroethoxy)propyl]phenyl]acetic acid (PubChem CID 66866218) has the molecular formula C21H20Cl3FO6S and a molecular weight of 525.81 g/mol. Its IUPAC name is 2-[4-[2-[2-(4-fluorophenyl)ethylsulfonyl]-3-oxo-3-(2,2,2-trichloroethoxy)propyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[2-(4-fluorophenyl)ethylsulfonyl]-3-oxo-3-(2,2,2-trichloroethoxy)propyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 66866218 |
| Molecular Formula | C21H20Cl3FO6S |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | 2-[4-[2-[2-(4-fluorophenyl)ethylsulfonyl]-3-oxo-3-(2,2,2-trichloroethoxy)propyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CC(C(=O)OCC(Cl)(Cl)Cl)S(=O)(=O)CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H20Cl3FO6S/c22-21(23,24)13-31-20(28)18(11-15-1-3-16(4-2-15)12-19(26)27)32(29,30)10-9-14-5-7-17(25)8-6-14/h1-8,18H,9-13H2,(H,26,27) |
| InChIKey | MIDHDLHYJOTBBF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|