C14H15F3N2O3S — CID 66866654
2-[2-(trifluoromethyl)phenyl]sulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 66866654) has the molecular formula C14H15F3N2O3S and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)phenyl]sulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-[2-(trifluoromethyl)phenyl]sulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 66866654 |
| Molecular Formula | C14H15F3N2O3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-[2-(trifluoromethyl)phenyl]sulfonyl-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CCC2CN(S(=O)(=O)c3ccccc3C(F)(F)F)CCN12 |
| InChI | InChI=1S/C14H15F3N2O3S/c15-14(16,17)11-3-1-2-4-12(11)23(21,22)18-7-8-19-10(9-18)5-6-13(19)20/h1-4,10H,5-9H2 |
| InChIKey | BSNPGYZAHDBGIB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |