C15H32N2O — CID 66867634
1,2,2,6,6-pentamethylpiperidine;piperidin-4-ol (PubChem CID 66867634) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethylpiperidine;piperidin-4-ol.
| Compound Name | 1,2,2,6,6-pentamethylpiperidine;piperidin-4-ol |
|---|---|
| PubChem CID | 66867634 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | 1,2,2,6,6-pentamethylpiperidine;piperidin-4-ol |
| SMILES | CN1C(C)(C)CCCC1(C)C.OC1CCNCC1 |
| InChI | InChI=1S/C10H21N.C5H11NO/c1-9(2)7-6-8-10(3,4)11(9)5;7-5-1-3-6-4-2-5/h6-8H2,1-5H3;5-7H,1-4H2 |
| InChIKey | OJGBKUIGCFUOIE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |