C28H32N2O2S2 — CID 66867796
N-(1-cyclohexyl-1,2-diphenyl-1,2-thiazolidin-3-ylidene)-4-methylbenzenesulfonamide (PubChem CID 66867796) has the molecular formula C28H32N2O2S2 and a molecular weight of 492.71 g/mol. Its IUPAC name is N-(1-cyclohexyl-1,2-diphenyl-1,2-thiazolidin-3-ylidene)-4-methylbenzenesulfonamide.
| Compound Name | N-(1-cyclohexyl-1,2-diphenyl-1,2-thiazolidin-3-ylidene)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 66867796 |
| Molecular Formula | C28H32N2O2S2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-(1-cyclohexyl-1,2-diphenyl-1,2-thiazolidin-3-ylidene)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2CCS(c3ccccc3)(C3CCCCC3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32N2O2S2/c1-23-17-19-27(20-18-23)34(31,32)29-28-21-22-33(25-13-7-3-8-14-25,26-15-9-4-10-16-26)30(28)24-11-5-2-6-12-24/h2-3,5-8,11-14,17-20,26H,4,9-10,15-16,21-22H2,1H3 |
| InChIKey | QZCAVNACWKBDGI-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|