C12H22N2O2 — CID 66867937
1,2,3,3,4-pentamethylcyclopentane-1,2-dicarboxamide (PubChem CID 66867937) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1,2,3,3,4-pentamethylcyclopentane-1,2-dicarboxamide.
| Compound Name | 1,2,3,3,4-pentamethylcyclopentane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 66867937 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1,2,3,3,4-pentamethylcyclopentane-1,2-dicarboxamide |
| SMILES | CC1CC(C)(C(N)=O)C(C)(C(N)=O)C1(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-7-6-11(4,8(13)15)12(5,9(14)16)10(7,2)3/h7H,6H2,1-5H3,(H2,13,15)(H2,14,16) |
| InChIKey | IGKVRAHEMZPJTB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |