C13H17ClN6O7S — CID 66868303
3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1,2-dimethyl-3H-pyrazole-4-carboxylic acid (PubChem CID 66868303) has the molecular formula C13H17ClN6O7S and a molecular weight of 436.83 g/mol. Its IUPAC name is 3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1,2-dimethyl-3H-pyrazole-4-carboxylic acid.
| Compound Name | 3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1,2-dimethyl-3H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 66868303 |
| Molecular Formula | C13H17ClN6O7S |
| Molecular Weight | 436.83 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 3-chloro-5-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-1,2-dimethyl-3H-pyrazole-4-carboxylic acid |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)C2=C(C(=O)O)C(Cl)N(C)N2C)n1 |
| InChI | InChI=1S/C13H17ClN6O7S/c1-19-9(14)8(11(21)22)10(20(19)2)28(24,25)18-13(23)17-12-15-6(26-3)5-7(16-12)27-4/h5,9H,1-4H3,(H,21,22)(H2,15,16,17,18,23) |
| InChIKey | ODYTUEBCHATTDP-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.83 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|