C24H28N4O2 — CID 66868403
6-butyl-N-(3-cyanophenyl)-8-methyl-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine-2-carboxamide (PubChem CID 66868403) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 6-butyl-N-(3-cyanophenyl)-8-methyl-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine-2-carboxamide.
| Compound Name | 6-butyl-N-(3-cyanophenyl)-8-methyl-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 66868403 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 6-butyl-N-(3-cyanophenyl)-8-methyl-1,3,4,7,8,10-hexahydropyrano[4,3-c][1,6]naphthyridine-2-carboxamide |
| SMILES | CCCCc1nc2c(c3c1CC(C)OC3)CN(C(=O)Nc1cccc(C#N)c1)CC2 |
| InChI | InChI=1S/C24H28N4O2/c1-3-4-8-22-19-11-16(2)30-15-21(19)20-14-28(10-9-23(20)27-22)24(29)26-18-7-5-6-17(12-18)13-25/h5-7,12,16H,3-4,8-11,14-15H2,1-2H3,(H,26,29) |
| InChIKey | PMHWGZSLQHQEOV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |