C27H28ClNO3 — CID 66868466
1-(4-chloro-2-methoxyphenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]cyclobutane-1-carboxamide (PubChem CID 66868466) has the molecular formula C27H28ClNO3 and a molecular weight of 449.98 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxyphenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]cyclobutane-1-carboxamide.
| Compound Name | 1-(4-chloro-2-methoxyphenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 66868466 |
| Molecular Formula | C27H28ClNO3 |
| Molecular Weight | 449.98 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1-(4-chloro-2-methoxyphenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]cyclobutane-1-carboxamide |
| SMILES | COc1cc(Cl)ccc1C1(C(=O)NCCc2ccc(OCc3ccccc3)cc2)CCC1 |
| InChI | InChI=1S/C27H28ClNO3/c1-31-25-18-22(28)10-13-24(25)27(15-5-16-27)26(30)29-17-14-20-8-11-23(12-9-20)32-19-21-6-3-2-4-7-21/h2-4,6-13,18H,5,14-17,19H2,1H3,(H,29,30) |
| InChIKey | QCRXRUKNCYBHHE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.98 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |