C23H30FN3O3S — CID 66868677
3-fluoro-N-[2-[[1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]propane-1-sulfonamide (PubChem CID 66868677) has the molecular formula C23H30FN3O3S and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]propane-1-sulfonamide.
| Compound Name | 3-fluoro-N-[2-[[1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 66868677 |
| Molecular Formula | C23H30FN3O3S |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 3-fluoro-N-[2-[[1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinolin-7-yl]oxy]ethyl]propane-1-sulfonamide |
| SMILES | O=S(=O)(CCCF)NCCOc1ccc2c(c1)C(C1(c3ccccn3)CCC1)NCC2 |
| InChI | InChI=1S/C23H30FN3O3S/c24-11-4-16-31(28,29)27-14-15-30-19-7-6-18-8-13-26-22(20(18)17-19)23(9-3-10-23)21-5-1-2-12-25-21/h1-2,5-7,12,17,22,26-27H,3-4,8-11,13-16H2 |
| InChIKey | NOFCDZPALRFKTD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|