C24H32ClN3O2S — CID 66868696
N-[2-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]amino]ethyl]propane-1-sulfonamide (PubChem CID 66868696) has the molecular formula C24H32ClN3O2S and a molecular weight of 462.06 g/mol. Its IUPAC name is N-[2-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]amino]ethyl]propane-1-sulfonamide.
| Compound Name | N-[2-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]amino]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 66868696 |
| Molecular Formula | C24H32ClN3O2S |
| Molecular Weight | 462.06 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-[2-[[1-[1-(4-chlorophenyl)cyclobutyl]-1,2,3,4-tetrahydroisoquinolin-7-yl]amino]ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCNc1ccc2c(c1)C(C1(c3ccc(Cl)cc3)CCC1)NCC2 |
| InChI | InChI=1S/C24H32ClN3O2S/c1-2-16-31(29,30)28-15-14-26-21-9-4-18-10-13-27-23(22(18)17-21)24(11-3-12-24)19-5-7-20(25)8-6-19/h4-9,17,23,26-28H,2-3,10-16H2,1H3 |
| InChIKey | AZAQILJLQZJARW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.06 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|