About ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate
ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate (PubChem CID 66869237) has the molecular formula C26H35Cl2N7O3
and a molecular weight of 564.52 g/mol. Its IUPAC name is ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate |
| PubChem CID | 66869237 |
| Molecular Formula | C26H35Cl2N7O3 |
| Molecular Weight | 564.52 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)C(c1cc(N2CCN(C)CC2)ncc1Cl)C(C(N)=O)c1cc(N2CCN(C)CC2)ncc1Cl |
| InChI | InChI=1S/C26H35Cl2N7O3/c1-4-38-26(37)24(18-14-22(31-16-20(18)28)35-11-7-33(3)8-12-35)23(25(29)36)17-13-21(30-15-19(17)27)34-9-5-32(2)6-10-34/h13-16,23-24H,4-12H2,1-3H3,(H2,29,36) |
| InChIKey | CGOSGCPCUTZQJZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 564.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate?
The IUPAC name of ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate (CID 66869237) is ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate.
What is the SMILES notation for ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate?
The canonical SMILES for ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate is CCOC(=O)C(c1cc(N2CCN(C)CC2)ncc1Cl)C(C(N)=O)c1cc(N2CCN(C)CC2)ncc1Cl.
What is the InChIKey of ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate?
The InChIKey is CGOSGCPCUTZQJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35Cl2N7O3/c1-4-38-26(37)24(18-14-22(31-16-20(18)28)35-11-7-33(3)8-12-35)23(25(29)36)17-13-21(30-15-19(17)27)34-9-5-32(2)6-10-34/h13-16,23-24H,4-12H2,1-3H3,(H2,29,36).
What are the key properties of ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate?
ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate has a molecular weight of 564.52 g/mol, XLogP of 2.20, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-amino-2,3-bis[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]-4-oxobutanoate is sourced from PubChem (CID 66869237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).