C20H23NO2 — CID 66869310
ethyl 4-[2-(3-methylphenyl)ethynyl]-2,3,5,6,7,7a-hexahydroindole-1-carboxylate (PubChem CID 66869310) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is ethyl 4-[2-(3-methylphenyl)ethynyl]-2,3,5,6,7,7a-hexahydroindole-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-methylphenyl)ethynyl]-2,3,5,6,7,7a-hexahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 66869310 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl 4-[2-(3-methylphenyl)ethynyl]-2,3,5,6,7,7a-hexahydroindole-1-carboxylate |
| SMILES | CCOC(=O)N1CCC2=C(C#Cc3cccc(C)c3)CCCC21 |
| InChI | InChI=1S/C20H23NO2/c1-3-23-20(22)21-13-12-18-17(8-5-9-19(18)21)11-10-16-7-4-6-15(2)14-16/h4,6-7,14,19H,3,5,8-9,12-13H2,1-2H3 |
| InChIKey | NPYOBWOVEFAZLC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|