C12H17N3 — CID 66869367
1,2,4a,5,6,6a,10a,11-octahydropyrazino[2,1-c][1,4]benzodiazepine (PubChem CID 66869367) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1,2,4a,5,6,6a,10a,11-octahydropyrazino[2,1-c][1,4]benzodiazepine.
| Compound Name | 1,2,4a,5,6,6a,10a,11-octahydropyrazino[2,1-c][1,4]benzodiazepine |
|---|---|
| PubChem CID | 66869367 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1,2,4a,5,6,6a,10a,11-octahydropyrazino[2,1-c][1,4]benzodiazepine |
| SMILES | C1=CC2CN3CCN=CC3CNC2C=C1 |
| InChI | InChI=1S/C12H17N3/c1-2-4-12-10(3-1)9-15-6-5-13-7-11(15)8-14-12/h1-4,7,10-12,14H,5-6,8-9H2 |
| InChIKey | ZIELPFDRKJMVFX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |