C23H30Cl2N3O6+ — CID 66870018
1-[(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-methylbutanoyl]-N-[(2R,3S)-3-ethoxy-5-oxooxolan-2-yl]pyrrolidin-1-ium-1-carboxamide (PubChem CID 66870018) has the molecular formula C23H30Cl2N3O6+ and a molecular weight of 515.41 g/mol. Its IUPAC name is 1-[(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-methylbutanoyl]-N-[(2R,3S)-3-ethoxy-5-oxooxolan-2-yl]pyrrolidin-1-ium-1-carboxamide.
| Compound Name | 1-[(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-methylbutanoyl]-N-[(2R,3S)-3-ethoxy-5-oxooxolan-2-yl]pyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 66870018 |
| Molecular Formula | C23H30Cl2N3O6+ |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 1-[(2S)-2-[(2,6-dichlorobenzoyl)amino]-3-methylbutanoyl]-N-[(2R,3S)-3-ethoxy-5-oxooxolan-2-yl]pyrrolidin-1-ium-1-carboxamide |
| SMILES | CCO[C@H]1CC(=O)O[C@H]1NC(=O)[N+]1(C(=O)[C@@H](NC(=O)c2c(Cl)cccc2Cl)C(C)C)CCCC1 |
| InChI | InChI=1S/C23H29Cl2N3O6/c1-4-33-16-12-17(29)34-21(16)27-23(32)28(10-5-6-11-28)22(31)19(13(2)3)26-20(30)18-14(24)8-7-9-15(18)25/h7-9,13,16,19,21H,4-6,10-12H2,1-3H3,(H-,26,27,30,32)/p+1/t16-,19-,21+/m0/s1 |
| InChIKey | MNPSPTMFJRMSLW-NBHGPNQESA-O |
| XLogP | 3.27 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|